The reaction SO2( g )+2H2S( g )3S( s )+2H2O( g ) is the basis of a suggested met
ID: 560706 • Letter: T
Question
The reaction SO2(g)+2H2S(g)3S(s)+2H2O(g) is the basis of a suggested method for removal of SO2 from power-plant stack gases. The standard free energy of each substance are GfS(s) = 0 kJ/mol, GfH2O(g) = -228.57 kJ/mol, GfSO2(g) = -300.4 kJ/mol, GfH2S(g) = -33.01 kJ/mol.
Part A What is the equilibrium constant for the reaction at 298 K?
Express your answer using one significant figure.
Part B In principle, is this reaction a feasible method of removing SO2?
Part C If PSO2 = PH2S and the vapor pressure of water is 25 torr , calculate the equilibrium SO2 pressure in the system at 298 K.
Express your answer using one significant figure.
Part D Would you expect the process to be more or less effective at higher temperatures?
-Yes -NoExplanation / Answer
SO2 (g) + 2 H2S (g) <==> 3 S(s) + 2H2O (g)
G°f S(s) = 0
G°f H2O(g) = -228.57 kJ/mol
G°f SO2(g) = -300.4 kJ/mol
G°f H2S(g) = -33.01 kJ/mol
G°r = 3 * G°f S(s) + 2 * G°f H2O(g) - G°f SO2(g) – 2 * G°f H2S(g)
= 3 (0) + 2 (-228.57) – (-300.4) – 2 (-33.01)
= -90.72 kJ/mol
At T = 298 K
Gr = G°r
a)
Gr = - R T ln(K)
R = 8.314 J/mol-K
90.72 = 8.314 x 10-3 * 298 * ln(K)
Ln(K) = 36.6
K = 8 x 1015
b)
Since G°r is negative at these conditions, the reaction is feasible.
Yes
c)
K = p(H2O)2 / [p(SO2) * p(H2S)]
p(SO2) = p(H2S)
So,
K = p(H2O)2 / p(SO2)2
8 x 1015 = (25 torr / p(SO2))2
8.9 x 107 = 25 torr / p(SO2)
p(SO2) = 2.8 x 10-7 torr
d)
3 moles of gas are yielding 2 moles of gas in the reaction
Therefore Sr < 0
Gr = Hr – T Sr
Gr will become less negative at higher temperatures.
Process will be less effective at higher temperatures.