Academic Integrity: tutoring, explanations, and feedback — we don’t complete graded work or submit on a student’s behalf.

3. a) Calculate the concentration of a new solution prepared by dissolving 1.5 m

ID: 712604 • Letter: 3

Question

3. a) Calculate the concentration of a new solution prepared by dissolving 1.5 mL of 2.5 M HCI in 48.5 mLf distilled water (50.0 mL final volume). (3 pts) Calculate the pH of the new solution. (2 pts) c) Is the new solution acidic or basic? (1 pts) 4. a) Write the acid dissociation constant (Ka) expression the following reaction. (2 pts) CH3COOH(aq) + H2On CH3COO" (aq) + H3O+(aq) b) If the K, of the reaction in part a) is equal to 1.8x10 , which is favored: the products or the reactants? (2 pts)

Explanation / Answer

3.

a) concentration of HCl = 1.5*2.5/(48.5+1.5) = 0.075 M

b) pH = -log(H3O+)

      = -log0.075

      = 1.125

c) the new solution is acidic

4

a)   Ka = [CH3COO-][H3O+]/[CH3COOH]

b) Aa Ka < 1 , it favours reactents.