The general formula for an aldehyde is _____. Question 1 options: Question 2 opt
ID: 816129 • Letter: T
Question
The general formula for an aldehyde is _____.
Question 1 options:
Question 2 options:
Question 3 options:
1) RCOOH 2) RCHO 3) RCOR 4) R2CO 5) RCH2OH The general formula for an aldehyde is _____. Question 1 options: 1) RCOOH 2) RCHO 3) RCOR 4) R2CO 5) RCH2OH What is the condensed formula of the compound shown here? Question 3 options: 1) alkane 2) aldehyde 3) ketone 4) carbonyl 5) carboxylic acid Question 2 options: 1) CH3CO(CH2)3CH(CH3)2 2) CH3OC(CH2)3CHCH3CH3 3) CH3CO(CH2)3CHCH3CH3 4) CH3OCCH2CH2CH2CH2CH(CH3)2 What type of compound is the compound shown here?Explanation / Answer
2. 1)
CH3CO(CH2)3CH(CH3)2
3. 3)
ketone
2. 1)
CH3CO(CH2)3CH(CH3)2
3. 3)
ketone