hydrogen reacts with NO to produce water and nitrogen gas. Determine the overall

Question

hydrogen reacts with NO to produce water and nitrogen gas. Determine the overall rate constant of this reaction as well as the overall rate law given the following information:

2NO(g) k1---> N2O2(g) fast
<----k-1
H2(g) + N2O2(g)------>k2 H2O(g) + N2O slow

N2O(g) + H2(g) ----> k3 N2(g) + H2O(g) fast

Explanation / Answer

2NO + 2H2 ==> N2 + 2H2O H2(g) + N2O2(g)------>k2 H2O(g) + N2O slow rate = k2 [H2O][N2O]/([H2][N2O2] 2NO(g) k1---> N2O2(g) fast k3 N2(g) + H2O(g) fast k3 = [N2][H2O]/[H2][N2O] [N2O] = [N2][H2O]/[H2]k3 so, rate = (k2/k1) {[H2O][N2][H2O]/[H2]k3[H2][NO]^2} rate = (k2/k1k3) {[H2O]^2[N2]/[H2]^2[NO]^2}

Related Questions

Navigate

• Browse (All)
• Browse H
• Subjects

---