Problem 16.70 Write the chemical equation and the K bexpression for the reaction

Question

Problem 16.70

Write the chemical equation and the Kbexpression for the reaction of each of the following bases with water.

Part A

Write the chemical equation for the reaction of propylamine, C3H7NH2 with water.

SubmitMy AnswersGive Up

Part B

Write the Kb expression for the reaction of propylamine, C3H7NH2 with water.

SubmitMy AnswersGive Up

Correct

Part C

Write the chemical equation for the reaction of monohydrogen phosphate ion, HPO42 with water.

SubmitMy AnswersGive Up

Part D

Write the Kb expression for the reaction of phosphate ion, HPO42 with water.

SubmitMy AnswersGive Up

Correct

Part E

Write the chemical equation for the reaction of benzoate ion, C6H5CO2 with water.

SubmitMy AnswersGive Up

Part F

Write the Kb expression for the reaction of benzoate ion, C6H5CO2 with water.

SubmitMy AnswersGive Up

Correct

Problem 16.70

Write the chemical equation and the Kbexpression for the reaction of each of the following bases with water.

Part A

Write the chemical equation for the reaction of propylamine, C3H7NH2 with water.

SubmitMy AnswersGive Up

Part B

Write the Kb expression for the reaction of propylamine, C3H7NH2 with water.

[C3H7NH+3][OH][C3H7NH2] [C3H7NH2][H2O][C3H7NH+3][OH] [C3H7NH2][C3H7NH+3][OH] [C3H7NH+3][OH][C3H7NH2][H2O]

SubmitMy AnswersGive Up

Correct

Part C

Write the chemical equation for the reaction of monohydrogen phosphate ion, HPO42 with water.

SubmitMy AnswersGive Up

Part D

Write the Kb expression for the reaction of phosphate ion, HPO42 with water.

[H2PO4][OH][HPO24][H2O] [HPO24][H2O][H2PO4][OH] [HPO24][H2PO4][OH] [H2PO4][OH][HPO24]

SubmitMy AnswersGive Up

Correct

Part E

Write the chemical equation for the reaction of benzoate ion, C6H5CO2 with water.

SubmitMy AnswersGive Up

Part F

Write the Kb expression for the reaction of benzoate ion, C6H5CO2 with water.

[C6H5COOH][OH][C6H5COO][H2O] [C6H5COO][H2O][C6H5COOH][OH] [C6H5COOH][OH][C6H5COO] [C6H5COO][C6H5COOH][OH]

SubmitMy AnswersGive Up

Correct

Explanation / Answer

A)

this is an amine so

C3H7NH2 + H2O <--> C3H7NH3+ + OH-

B)

Kb = products/ reactants

note that h2o shall not be included since it is LIQUID

KB = [C3H7NH3 +][OH-]/[C3H7NH2 ]

C)

HPO4-2 +H2O <--> H2PO4- + OH-

d)

Kb = products/ reactants

note that h2o shall not be included since it is LIQUID

HPO4-2 +H2O <--> H2PO4- + OH-

Kb = [H2PO4-][OH-]/[HPO4-2]

e)

C6H5CO2- +H2O <--> C6H5CO2H + OH-

f)

Kb = [C6H5CO2H][OH-]/[C6H5CO2-]

Related Questions

Navigate

• Browse (All)
• Browse P
• Subjects

---